C15H20F2N2O6S — CID 8954623
[(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-[(3,4-difluorophenyl)sulfonylamino]propanoate (PubChem CID 8954623) has the molecular formula C15H20F2N2O6S and a molecular weight of 394.40 g/mol. Its IUPAC name is [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-[(3,4-difluorophenyl)sulfonylamino]propanoate.
| Compound Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-[(3,4-difluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8954623 |
| Molecular Formula | C15H20F2N2O6S |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [(2R)-1-(2-methoxyethylamino)-1-oxopropan-2-yl] 3-[(3,4-difluorophenyl)sulfonylamino]propanoate |
| SMILES | COCCNC(=O)[C@@H](C)OC(=O)CCNS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H20F2N2O6S/c1-10(15(21)18-7-8-24-2)25-14(20)5-6-19-26(22,23)11-3-4-12(16)13(17)9-11/h3-4,9-10,19H,5-8H2,1-2H3,(H,18,21)/t10-/m1/s1 |
| InChIKey | VESLBADZIJMOFB-SNVBAGLBSA-N |
| XLogP | 0.33 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|