C20H19ClF3N3O6S — CID 98417387
[(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-[(4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 98417387) has the molecular formula C20H19ClF3N3O6S and a molecular weight of 521.90 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-[(4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | [(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-[(4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 98417387 |
| Molecular Formula | C20H19ClF3N3O6S |
| Molecular Weight | 521.90 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | [(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-[(4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@H](OC(=O)CCNS(=O)(=O)c1ccc(Cl)cc1)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H19ClF3N3O6S/c1-11(20(30)25-10-16(28)27-15-7-6-14(22)18(23)19(15)24)33-17(29)8-9-26-34(31,32)13-4-2-12(21)3-5-13/h2-7,11,26H,8-10H2,1H3,(H,25,30)(H,27,28)/t11-/m0/s1 |
| InChIKey | NKFRLSMUNIMRSI-NSHDSACASA-N |
| XLogP | 2.11 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.90 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|