C17H13Cl2F3N2O3 — CID 40811109
(2S)-2-(2,5-dichlorophenoxy)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 40811109) has the molecular formula C17H13Cl2F3N2O3 and a molecular weight of 421.20 g/mol. Its IUPAC name is (2S)-2-(2,5-dichlorophenoxy)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | (2S)-2-(2,5-dichlorophenoxy)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 40811109 |
| Molecular Formula | C17H13Cl2F3N2O3 |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | (2S)-2-(2,5-dichlorophenoxy)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | C[C@H](Oc1cc(Cl)ccc1Cl)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13Cl2F3N2O3/c1-8(27-13-6-9(18)2-3-10(13)19)17(26)23-7-14(25)24-12-5-4-11(20)15(21)16(12)22/h2-6,8H,7H2,1H3,(H,23,26)(H,24,25)/t8-/m0/s1 |
| InChIKey | YXKXCIKCPXELTA-QMMMGPOBSA-N |
| XLogP | 3.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|