C19H16F4N2O5 — CID 55378824
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-fluoro-4-methoxybenzoate (PubChem CID 55378824) has the molecular formula C19H16F4N2O5 and a molecular weight of 428.34 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-fluoro-4-methoxybenzoate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 55378824 |
| Molecular Formula | C19H16F4N2O5 |
| Molecular Weight | 428.34 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C19H16F4N2O5/c1-9(30-19(28)11-4-3-10(29-2)7-13(11)21)18(27)24-8-15(26)25-14-6-5-12(20)16(22)17(14)23/h3-7,9H,8H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | SUHAIYZIZRMAMV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|