C19H15F3N2O6 — CID 2672177
[(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 1,3-benzodioxole-5-carboxylate (PubChem CID 2672177) has the molecular formula C19H15F3N2O6 and a molecular weight of 424.33 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 1,3-benzodioxole-5-carboxylate.
| Compound Name | [(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 2672177 |
| Molecular Formula | C19H15F3N2O6 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [(2S)-1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 1,3-benzodioxole-5-carboxylate |
| SMILES | C[C@H](OC(=O)c1ccc2c(c1)OCO2)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H15F3N2O6/c1-9(30-19(27)10-2-5-13-14(6-10)29-8-28-13)18(26)23-7-15(25)24-12-4-3-11(20)16(21)17(12)22/h2-6,9H,7-8H2,1H3,(H,23,26)(H,24,25)/t9-/m0/s1 |
| InChIKey | JOMOCRCMTAIBQO-VIFPVBQESA-N |
| XLogP | 2.13 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|