C23H25F3N2O6 — CID 42981521
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-ethoxy-4-propoxybenzoate (PubChem CID 42981521) has the molecular formula C23H25F3N2O6 and a molecular weight of 482.46 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-ethoxy-4-propoxybenzoate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-ethoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 42981521 |
| Molecular Formula | C23H25F3N2O6 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 3-ethoxy-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)OC(C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1OCC |
| InChI | InChI=1S/C23H25F3N2O6/c1-4-10-33-17-9-6-14(11-18(17)32-5-2)23(31)34-13(3)22(30)27-12-19(29)28-16-8-7-15(24)20(25)21(16)26/h6-9,11,13H,4-5,10,12H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | GYMALCYEANDJKR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|