C20H20F3NO5 — CID 7278224
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-methoxy-4-propoxybenzoate (PubChem CID 7278224) has the molecular formula C20H20F3NO5 and a molecular weight of 411.38 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-methoxy-4-propoxybenzoate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 7278224 |
| Molecular Formula | C20H20F3NO5 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)O[C@H](C)C(=O)Nc2ccc(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C20H20F3NO5/c1-4-9-28-15-8-5-12(10-16(15)27-3)20(26)29-11(2)19(25)24-14-7-6-13(21)17(22)18(14)23/h5-8,10-11H,4,9H2,1-3H3,(H,24,25)/t11-/m1/s1 |
| InChIKey | MNRCDGKBVAMPNK-LLVKDONJSA-N |
| XLogP | 4.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|