C20H19BrF3NO5 — CID 42973698
[1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-bromo-5-methoxy-4-propoxybenzoate (PubChem CID 42973698) has the molecular formula C20H19BrF3NO5 and a molecular weight of 490.27 g/mol. Its IUPAC name is [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-bromo-5-methoxy-4-propoxybenzoate.
| Compound Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-bromo-5-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 42973698 |
| Molecular Formula | C20H19BrF3NO5 |
| Molecular Weight | 490.27 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | [1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 3-bromo-5-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1c(Br)cc(C(=O)OC(C)C(=O)Nc2ccc(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C20H19BrF3NO5/c1-4-7-29-18-12(21)8-11(9-15(18)28-3)20(27)30-10(2)19(26)25-14-6-5-13(22)16(23)17(14)24/h5-6,8-10H,4,7H2,1-3H3,(H,25,26) |
| InChIKey | JYPXVJLHQXFTQZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.27 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|