C14H19NO5 — CID 2600269
[(2R)-1-amino-1-oxopropan-2-yl] 3-methoxy-4-propoxybenzoate (PubChem CID 2600269) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl] 3-methoxy-4-propoxybenzoate.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl] 3-methoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 2600269 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl] 3-methoxy-4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)O[C@H](C)C(N)=O)cc1OC |
| InChI | InChI=1S/C14H19NO5/c1-4-7-19-11-6-5-10(8-12(11)18-3)14(17)20-9(2)13(15)16/h5-6,8-9H,4,7H2,1-3H3,(H2,15,16)/t9-/m1/s1 |
| InChIKey | BAMSPLCYCRXSBG-SECBINFHSA-N |
| XLogP | 1.51 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |