C16H23NO5 — CID 2540833
[(2S)-1-amino-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate (PubChem CID 2540833) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate |
|---|---|
| PubChem CID | 2540833 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)O[C@@H](C)C(N)=O)cc1OCC |
| InChI | InChI=1S/C16H23NO5/c1-4-6-9-21-13-8-7-12(10-14(13)20-5-2)16(19)22-11(3)15(17)18/h7-8,10-11H,4-6,9H2,1-3H3,(H2,17,18)/t11-/m0/s1 |
| InChIKey | HQVNINPLZSKEBU-NSHDSACASA-N |
| XLogP | 2.29 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|