C18H26N2O6 — CID 7542290
[(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate (PubChem CID 7542290) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate.
| Compound Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate |
|---|---|
| PubChem CID | 7542290 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | [(2S)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)O[C@@H](C)C(=O)NC(=O)NC)cc1OCC |
| InChI | InChI=1S/C18H26N2O6/c1-5-7-10-25-14-9-8-13(11-15(14)24-6-2)17(22)26-12(3)16(21)20-18(23)19-4/h8-9,11-12H,5-7,10H2,1-4H3,(H2,19,20,21,23)/t12-/m0/s1 |
| InChIKey | CGLUSAGQOBOHDB-LBPRGKRZSA-N |
| XLogP | 2.27 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|