C23H29NO5 — CID 7904130
[(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate (PubChem CID 7904130) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate.
| Compound Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate |
|---|---|
| PubChem CID | 7904130 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-butoxy-3-ethoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)O[C@@H](C)C(=O)Nc2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C23H29NO5/c1-5-7-14-28-20-13-10-18(15-21(20)27-6-2)23(26)29-17(4)22(25)24-19-11-8-16(3)9-12-19/h8-13,15,17H,5-7,14H2,1-4H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | NCNDKAOELNYCDF-KRWDZBQOSA-N |
| XLogP | 4.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|