C22H18F3N3O6 — CID 42984656
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 42984656) has the molecular formula C22H18F3N3O6 and a molecular weight of 477.40 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 42984656 |
| Molecular Formula | C22H18F3N3O6 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | CC(OC(=O)c1ccc(N2C(=O)CCC2=O)cc1)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C22H18F3N3O6/c1-11(21(32)26-10-16(29)27-15-7-6-14(23)19(24)20(15)25)34-22(33)12-2-4-13(5-3-12)28-17(30)8-9-18(28)31/h2-7,11H,8-10H2,1H3,(H,26,32)(H,27,29) |
| InChIKey | TVBDTXXWMMEHIS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|