C22H20F3N3O5 — CID 166413628
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 4-[methyl(prop-2-enoyl)amino]benzoate (PubChem CID 166413628) has the molecular formula C22H20F3N3O5 and a molecular weight of 463.41 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 4-[methyl(prop-2-enoyl)amino]benzoate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 4-[methyl(prop-2-enoyl)amino]benzoate |
|---|---|
| PubChem CID | 166413628 |
| Molecular Formula | C22H20F3N3O5 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 4-[methyl(prop-2-enoyl)amino]benzoate |
| SMILES | C=CC(=O)N(C)c1ccc(C(=O)OC(C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H20F3N3O5/c1-4-18(30)28(3)14-7-5-13(6-8-14)22(32)33-12(2)21(31)26-11-17(29)27-16-10-9-15(23)19(24)20(16)25/h4-10,12H,1,11H2,2-3H3,(H,26,31)(H,27,29) |
| InChIKey | CCVWTFDTCVJXQU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|