C20H19F3N2O4 — CID 6915116
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2,4-dimethylbenzoate (PubChem CID 6915116) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2,4-dimethylbenzoate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 6915116 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OC(C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-10-4-5-13(11(2)8-10)20(28)29-12(3)19(27)24-9-16(26)25-15-7-6-14(21)17(22)18(15)23/h4-8,12H,9H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | ZBDNQXQNEMZQPU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|