C21H16ClF3N2O5 — CID 55380388
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 55380388) has the molecular formula C21H16ClF3N2O5 and a molecular weight of 468.82 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 55380388 |
| Molecular Formula | C21H16ClF3N2O5 |
| Molecular Weight | 468.82 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)OC(C)C(=O)NCC(=O)Nc2ccc(F)c(F)c2F)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H16ClF3N2O5/c1-9-12-7-11(22)3-6-15(12)32-19(9)21(30)31-10(2)20(29)26-8-16(28)27-14-5-4-13(23)17(24)18(14)25/h3-7,10H,8H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | CFHKLXWKEXFRTA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|