C18H13BrF4N2O4 — CID 46611062
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-bromo-5-fluorobenzoate (PubChem CID 46611062) has the molecular formula C18H13BrF4N2O4 and a molecular weight of 477.21 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-bromo-5-fluorobenzoate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-bromo-5-fluorobenzoate |
|---|---|
| PubChem CID | 46611062 |
| Molecular Formula | C18H13BrF4N2O4 |
| Molecular Weight | 477.21 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] 2-bromo-5-fluorobenzoate |
| SMILES | CC(OC(=O)c1cc(F)ccc1Br)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H13BrF4N2O4/c1-8(29-18(28)10-6-9(20)2-3-11(10)19)17(27)24-7-14(26)25-13-5-4-12(21)15(22)16(13)23/h2-6,8H,7H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | WPNYUWXVSDIGCA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|