C20H16BrF3N2O4 — CID 6216226
[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 6216226) has the molecular formula C20H16BrF3N2O4 and a molecular weight of 485.26 g/mol. Its IUPAC name is [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6216226 |
| Molecular Formula | C20H16BrF3N2O4 |
| Molecular Weight | 485.26 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | [1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1cccc(Br)c1)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H16BrF3N2O4/c1-11(30-17(28)8-5-12-3-2-4-13(21)9-12)20(29)25-10-16(27)26-15-7-6-14(22)18(23)19(15)24/h2-9,11H,10H2,1H3,(H,25,29)(H,26,27)/b8-5+ |
| InChIKey | SVDOHPOMHAIHAI-VMPITWQZSA-N |
| XLogP | 3.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|