C19H24BrNO3 — CID 7808462
[(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate (PubChem CID 7808462) has the molecular formula C19H24BrNO3 and a molecular weight of 394.31 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7808462 |
| Molecular Formula | C19H24BrNO3 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | [(2R)-1-(cyclohexylmethylamino)-1-oxopropan-2-yl] (E)-3-(3-bromophenyl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1cccc(Br)c1)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C19H24BrNO3/c1-14(19(23)21-13-16-6-3-2-4-7-16)24-18(22)11-10-15-8-5-9-17(20)12-15/h5,8-12,14,16H,2-4,6-7,13H2,1H3,(H,21,23)/b11-10+/t14-/m1/s1 |
| InChIKey | KGBZARJXJIJBSP-PLSXKVAHSA-N |
| XLogP | 4.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|