C11H13ClF3N3O2 — CID 119268558
2-amino-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide;hydrochloride (PubChem CID 119268558) has the molecular formula C11H13ClF3N3O2 and a molecular weight of 311.69 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119268558 |
| Molecular Formula | C11H13ClF3N3O2 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-amino-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide;hydrochloride |
| SMILES | CC(N)C(=O)NCC(=O)Nc1ccc(F)c(F)c1F.Cl |
| InChI | InChI=1S/C11H12F3N3O2.ClH/c1-5(15)11(19)16-4-8(18)17-7-3-2-6(12)9(13)10(7)14;/h2-3,5H,4,15H2,1H3,(H,16,19)(H,17,18);1H |
| InChIKey | UUXFCHXZAGFOOV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|