C17H23F3N4O2 — CID 120771602
2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 120771602) has the molecular formula C17H23F3N4O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 120771602 |
| Molecular Formula | C17H23F3N4O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | CC(C(=O)NCC(=O)Nc1ccc(F)c(F)c1F)N1CCC(C)(CN)C1 |
| InChI | InChI=1S/C17H23F3N4O2/c1-10(24-6-5-17(2,8-21)9-24)16(26)22-7-13(25)23-12-4-3-11(18)14(19)15(12)20/h3-4,10H,5-9,21H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | FFXPHXIBQZNASF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|