C23H25F3N4O3 — CID 46687552
1-[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl]-N-phenylpiperidine-3-carboxamide (PubChem CID 46687552) has the molecular formula C23H25F3N4O3 and a molecular weight of 462.47 g/mol. Its IUPAC name is 1-[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 46687552 |
| Molecular Formula | C23H25F3N4O3 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-[1-oxo-1-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]propan-2-yl]-N-phenylpiperidine-3-carboxamide |
| SMILES | CC(C(=O)NCC(=O)Nc1ccc(F)c(F)c1F)N1CCCC(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C23H25F3N4O3/c1-14(22(32)27-12-19(31)29-18-10-9-17(24)20(25)21(18)26)30-11-5-6-15(13-30)23(33)28-16-7-3-2-4-8-16/h2-4,7-10,14-15H,5-6,11-13H2,1H3,(H,27,32)(H,28,33)(H,29,31) |
| InChIKey | NSUDOJFYQKFDDY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|