C21H21F4N3O3 — CID 46571507
2-[2-(4-fluorophenyl)morpholin-4-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 46571507) has the molecular formula C21H21F4N3O3 and a molecular weight of 439.41 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)morpholin-4-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | 2-[2-(4-fluorophenyl)morpholin-4-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 46571507 |
| Molecular Formula | C21H21F4N3O3 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[2-(4-fluorophenyl)morpholin-4-yl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | CC(C(=O)NCC(=O)Nc1ccc(F)c(F)c1F)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H21F4N3O3/c1-12(28-8-9-31-17(11-28)13-2-4-14(22)5-3-13)21(30)26-10-18(29)27-16-7-6-15(23)19(24)20(16)25/h2-7,12,17H,8-11H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | MTYMCMZOFPUCTN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|