C19H19F3N2O2 — CID 46571268
N-(2,4-difluorophenyl)-2-[2-(4-fluorophenyl)morpholin-4-yl]propanamide (PubChem CID 46571268) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[2-(4-fluorophenyl)morpholin-4-yl]propanamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[2-(4-fluorophenyl)morpholin-4-yl]propanamide |
|---|---|
| PubChem CID | 46571268 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[2-(4-fluorophenyl)morpholin-4-yl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(F)cc1F)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H19F3N2O2/c1-12(19(25)23-17-7-6-15(21)10-16(17)22)24-8-9-26-18(11-24)13-2-4-14(20)5-3-13/h2-7,10,12,18H,8-9,11H2,1H3,(H,23,25) |
| InChIKey | RKLJOXZHKXEXDM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |