C20H20ClF3N2O2 — CID 55827029
2-[2-(4-chlorophenyl)morpholin-4-yl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 55827029) has the molecular formula C20H20ClF3N2O2 and a molecular weight of 412.84 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)morpholin-4-yl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55827029 |
| Molecular Formula | C20H20ClF3N2O2 |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 2-[2-(4-chlorophenyl)morpholin-4-yl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccccc1C(F)(F)F)N1CCOC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H20ClF3N2O2/c1-13(19(27)25-17-5-3-2-4-16(17)20(22,23)24)26-10-11-28-18(12-26)14-6-8-15(21)9-7-14/h2-9,13,18H,10-12H2,1H3,(H,25,27) |
| InChIKey | DPUMHRHGCGABKR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |