C16H18ClN3O2S — CID 100842922
(2S)-2-[(2S)-2-(4-chlorophenyl)morpholin-4-yl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 100842922) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is (2S)-2-[(2S)-2-(4-chlorophenyl)morpholin-4-yl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | (2S)-2-[(2S)-2-(4-chlorophenyl)morpholin-4-yl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 100842922 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (2S)-2-[(2S)-2-(4-chlorophenyl)morpholin-4-yl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1nccs1)N1CCO[C@@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H18ClN3O2S/c1-11(15(21)19-16-18-6-9-23-16)20-7-8-22-14(10-20)12-2-4-13(17)5-3-12/h2-6,9,11,14H,7-8,10H2,1H3,(H,18,19,21)/t11-,14+/m0/s1 |
| InChIKey | XMPPVGUWYQXABM-SMDDNHRTSA-N |
| XLogP | 3.20 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |