C14H14ClN3O2S — CID 97057644
1-[(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 97057644) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 1-[(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 97057644 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 1-[(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nccs1)N[C@@H]1CCO[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClN3O2S/c15-10-3-1-9(2-4-10)12-11(5-7-20-12)17-13(19)18-14-16-6-8-21-14/h1-4,6,8,11-12H,5,7H2,(H2,16,17,18,19)/t11-,12-/m1/s1 |
| InChIKey | QOFADJJKBPMMAU-VXGBXAGGSA-N |
| XLogP | 3.45 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |