C15H16ClN3O2S — CID 56822946
1-[4-(4-chlorophenyl)oxan-4-yl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 56822946) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)oxan-4-yl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[4-(4-chlorophenyl)oxan-4-yl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 56822946 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[4-(4-chlorophenyl)oxan-4-yl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nccs1)NC1(c2ccc(Cl)cc2)CCOCC1 |
| InChI | InChI=1S/C15H16ClN3O2S/c16-12-3-1-11(2-4-12)15(5-8-21-9-6-15)19-13(20)18-14-17-7-10-22-14/h1-4,7,10H,5-6,8-9H2,(H2,17,18,19,20) |
| InChIKey | RYLXZFJWMOIYMD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |