C12H12ClN3O2S — CID 47149786
1-[2-(4-chlorophenoxy)ethyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 47149786) has the molecular formula C12H12ClN3O2S and a molecular weight of 297.77 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-(4-chlorophenoxy)ethyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 47149786 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)Nc1nccs1 |
| InChI | InChI=1S/C12H12ClN3O2S/c13-9-1-3-10(4-2-9)18-7-5-14-11(17)16-12-15-6-8-19-12/h1-4,6,8H,5,7H2,(H2,14,15,16,17) |
| InChIKey | YEIAMXMYCBWCDE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|