C13H12ClN5O2S — CID 54599213
N-[(E)-(4-chlorophenyl)methylideneamino]-2-(1,3-thiazol-2-ylcarbamoylamino)acetamide (PubChem CID 54599213) has the molecular formula C13H12ClN5O2S and a molecular weight of 337.79 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-2-(1,3-thiazol-2-ylcarbamoylamino)acetamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2-(1,3-thiazol-2-ylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 54599213 |
| Molecular Formula | C13H12ClN5O2S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-2-(1,3-thiazol-2-ylcarbamoylamino)acetamide |
| SMILES | O=C(CNC(=O)Nc1nccs1)N/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12ClN5O2S/c14-10-3-1-9(2-4-10)7-17-19-11(20)8-16-12(21)18-13-15-5-6-22-13/h1-7H,8H2,(H,19,20)(H2,15,16,18,21)/b17-7+ |
| InChIKey | RYICABPUUHBRDW-REZTVBANSA-N |
| XLogP | 2.07 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|