C13H11ClN2O2S — CID 23934454
4-(4-chlorophenyl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 23934454) has the molecular formula C13H11ClN2O2S and a molecular weight of 294.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(4-chlorophenyl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 23934454 |
| Molecular Formula | C13H11ClN2O2S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 4-(4-chlorophenyl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)cc1)Nc1nccs1 |
| InChI | InChI=1S/C13H11ClN2O2S/c14-10-3-1-9(2-4-10)11(17)5-6-12(18)16-13-15-7-8-19-13/h1-4,7-8H,5-6H2,(H,15,16,18) |
| InChIKey | DHHUPYHYHVPOFH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |