C17H21N3O2S — CID 8762604
4-tert-butyl-N-[3-oxo-3-(1,3-thiazol-2-ylamino)propyl]benzamide (PubChem CID 8762604) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-oxo-3-(1,3-thiazol-2-ylamino)propyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-oxo-3-(1,3-thiazol-2-ylamino)propyl]benzamide |
|---|---|
| PubChem CID | 8762604 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 4-tert-butyl-N-[3-oxo-3-(1,3-thiazol-2-ylamino)propyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NCCC(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C17H21N3O2S/c1-17(2,3)13-6-4-12(5-7-13)15(22)18-9-8-14(21)20-16-19-10-11-23-16/h4-7,10-11H,8-9H2,1-3H3,(H,18,22)(H,19,20,21) |
| InChIKey | JUGQKLQAFULSHR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |