C14H14N2O2S — CID 23849935
4-(4-methylphenyl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 23849935) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-(4-methylphenyl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(4-methylphenyl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 23849935 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-(4-methylphenyl)-4-oxo-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C14H14N2O2S/c1-10-2-4-11(5-3-10)12(17)6-7-13(18)16-14-15-8-9-19-14/h2-5,8-9H,6-7H2,1H3,(H,15,16,18) |
| InChIKey | NPRVRQWRNLPYEY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |