C7H12ClN3OS — CID 168719847
4-amino-N-(1,3-thiazol-2-yl)butanamide;hydrochloride (PubChem CID 168719847) has the molecular formula C7H12ClN3OS and a molecular weight of 221.71 g/mol. Its IUPAC name is 4-amino-N-(1,3-thiazol-2-yl)butanamide;hydrochloride.
| Compound Name | 4-amino-N-(1,3-thiazol-2-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 168719847 |
| Molecular Formula | C7H12ClN3OS |
| Molecular Weight | 221.71 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 4-amino-N-(1,3-thiazol-2-yl)butanamide;hydrochloride |
| SMILES | Cl.NCCCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C7H11N3OS.ClH/c8-3-1-2-6(11)10-7-9-4-5-12-7;/h4-5H,1-3,8H2,(H,9,10,11);1H |
| InChIKey | ZJSVTGUWLFERDH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.71 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |