C13H13BrN2O2S — CID 2679212
4-(4-bromophenoxy)-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 2679212) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 4-(4-bromophenoxy)-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(4-bromophenoxy)-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 2679212 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 4-(4-bromophenoxy)-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | O=C(CCCOc1ccc(Br)cc1)Nc1nccs1 |
| InChI | InChI=1S/C13H13BrN2O2S/c14-10-3-5-11(6-4-10)18-8-1-2-12(17)16-13-15-7-9-19-13/h3-7,9H,1-2,8H2,(H,15,16,17) |
| InChIKey | HSVJXWZSRYFGMH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|