C10H19N3OS — CID 143608752
methanamine;N-(1,3-thiazol-2-yl)hexanamide (PubChem CID 143608752) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is methanamine;N-(1,3-thiazol-2-yl)hexanamide.
| Compound Name | methanamine;N-(1,3-thiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 143608752 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | methanamine;N-(1,3-thiazol-2-yl)hexanamide |
| SMILES | CCCCCC(=O)Nc1nccs1.CN |
| InChI | InChI=1S/C9H14N2OS.CH5N/c1-2-3-4-5-8(12)11-9-10-6-7-13-9;1-2/h6-7H,2-5H2,1H3,(H,10,11,12);2H2,1H3 |
| InChIKey | KSWFEKPWBKNYQN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|