C20H35N3O2S — CID 42664145
N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-N-pentyldecanamide (PubChem CID 42664145) has the molecular formula C20H35N3O2S and a molecular weight of 381.59 g/mol. Its IUPAC name is N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-N-pentyldecanamide.
| Compound Name | N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-N-pentyldecanamide |
|---|---|
| PubChem CID | 42664145 |
| Molecular Formula | C20H35N3O2S |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-N-pentyldecanamide |
| SMILES | CCCCCCCCCC(=O)N(CCCCC)CC(=O)Nc1nccs1 |
| InChI | InChI=1S/C20H35N3O2S/c1-3-5-7-8-9-10-11-13-19(25)23(15-12-6-4-2)17-18(24)22-20-21-14-16-26-20/h14,16H,3-13,15,17H2,1-2H3,(H,21,22,24) |
| InChIKey | LIDWZFOHUCUQAD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|