C19H25N3O4S — CID 4151032
2,4-dimethoxy-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-N-pentylbenzamide (PubChem CID 4151032) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-N-pentylbenzamide.
| Compound Name | 2,4-dimethoxy-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 4151032 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2,4-dimethoxy-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-N-pentylbenzamide |
| SMILES | CCCCCN(CC(=O)Nc1nccs1)C(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H25N3O4S/c1-4-5-6-10-22(13-17(23)21-19-20-9-11-27-19)18(24)15-8-7-14(25-2)12-16(15)26-3/h7-9,11-12H,4-6,10,13H2,1-3H3,(H,20,21,23) |
| InChIKey | SHHIHQILOBADNT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|