C18H23N3O5S — CID 5215660
3,5-dimethoxy-N-(3-methoxypropyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide (PubChem CID 5215660) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(3-methoxypropyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-(3-methoxypropyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 5215660 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3,5-dimethoxy-N-(3-methoxypropyl)-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]benzamide |
| SMILES | COCCCN(CC(=O)Nc1nccs1)C(=O)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C18H23N3O5S/c1-24-7-4-6-21(12-16(22)20-18-19-5-8-27-18)17(23)13-9-14(25-2)11-15(10-13)26-3/h5,8-11H,4,6-7,12H2,1-3H3,(H,19,20,22) |
| InChIKey | LHIFWNUPRKCDFS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|