C16H25N3O4S — CID 3700860
ethyl 4-oxo-4-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-pentylamino]butanoate (PubChem CID 3700860) has the molecular formula C16H25N3O4S and a molecular weight of 355.46 g/mol. Its IUPAC name is ethyl 4-oxo-4-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-pentylamino]butanoate.
| Compound Name | ethyl 4-oxo-4-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-pentylamino]butanoate |
|---|---|
| PubChem CID | 3700860 |
| Molecular Formula | C16H25N3O4S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | ethyl 4-oxo-4-[[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-pentylamino]butanoate |
| SMILES | CCCCCN(CC(=O)Nc1nccs1)C(=O)CCC(=O)OCC |
| InChI | InChI=1S/C16H25N3O4S/c1-3-5-6-10-19(14(21)7-8-15(22)23-4-2)12-13(20)18-16-17-9-11-24-16/h9,11H,3-8,10,12H2,1-2H3,(H,17,18,20) |
| InChIKey | ZOGQNMSBOSNPJB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|