C17H23N3O2S2 — CID 5085333
N-hexyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 5085333) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-hexyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-hexyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 5085333 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-hexyl-N-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | CCCCCCN(CC(=O)Nc1nccs1)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-2-3-4-5-9-20(16(22)12-14-7-6-10-23-14)13-15(21)19-17-18-8-11-24-17/h6-8,10-11H,2-5,9,12-13H2,1H3,(H,18,19,21) |
| InChIKey | COAQVFOGXSKCHW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|