C16H21N3O3S2 — CID 4087394
2-[benzenesulfonyl(pentyl)amino]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 4087394) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-[benzenesulfonyl(pentyl)amino]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[benzenesulfonyl(pentyl)amino]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4087394 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-[benzenesulfonyl(pentyl)amino]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCCN(CC(=O)Nc1nccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21N3O3S2/c1-2-3-7-11-19(13-15(20)18-16-17-10-12-23-16)24(21,22)14-8-5-4-6-9-14/h4-6,8-10,12H,2-3,7,11,13H2,1H3,(H,17,18,20) |
| InChIKey | YUEMMRDRKAXRLQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|