C12H12N2O3S2 — CID 3158209
2-benzylsulfonyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 3158209) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-benzylsulfonyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-benzylsulfonyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3158209 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-benzylsulfonyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CS(=O)(=O)Cc1ccccc1)Nc1nccs1 |
| InChI | InChI=1S/C12H12N2O3S2/c15-11(14-12-13-6-7-18-12)9-19(16,17)8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,13,14,15) |
| InChIKey | NBHAPLDERTXVJF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |