C19H26N4O3S2 — CID 92634989
2-[(4R)-4-[benzylsulfonyl(methyl)amino]azepan-1-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 92634989) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 2-[(4R)-4-[benzylsulfonyl(methyl)amino]azepan-1-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(4R)-4-[benzylsulfonyl(methyl)amino]azepan-1-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 92634989 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-[(4R)-4-[benzylsulfonyl(methyl)amino]azepan-1-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CN([C@@H]1CCCN(CC(=O)Nc2nccs2)CC1)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H26N4O3S2/c1-22(28(25,26)15-16-6-3-2-4-7-16)17-8-5-11-23(12-9-17)14-18(24)21-19-20-10-13-27-19/h2-4,6-7,10,13,17H,5,8-9,11-12,14-15H2,1H3,(H,20,21,24)/t17-/m1/s1 |
| InChIKey | VXKLMRFTOHBEAQ-QGZVFWFLSA-N |
| XLogP | 2.40 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |