C16H18FN3OS — CID 16674348
2-[4-(2-fluorophenyl)piperidin-1-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 16674348) has the molecular formula C16H18FN3OS and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperidin-1-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[4-(2-fluorophenyl)piperidin-1-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16674348 |
| Molecular Formula | C16H18FN3OS |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperidin-1-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1CCC(c2ccccc2F)CC1)Nc1nccs1 |
| InChI | InChI=1S/C16H18FN3OS/c17-14-4-2-1-3-13(14)12-5-8-20(9-6-12)11-15(21)19-16-18-7-10-22-16/h1-4,7,10,12H,5-6,8-9,11H2,(H,18,19,21) |
| InChIKey | WVWYHZAZIPLQQO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |