C14H15FN4O2S — CID 171999925
2-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 171999925) has the molecular formula C14H15FN4O2S and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 171999925 |
| Molecular Formula | C14H15FN4O2S |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CN1CCC(Oc2cccc(F)n2)C1)Nc1nccs1 |
| InChI | InChI=1S/C14H15FN4O2S/c15-11-2-1-3-13(17-11)21-10-4-6-19(8-10)9-12(20)18-14-16-5-7-22-14/h1-3,5,7,10H,4,6,8-9H2,(H,16,18,20) |
| InChIKey | SCVHYNGEBJNWFC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|