C17H17BrFN3O2 — CID 171704756
N-(4-bromophenyl)-2-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]acetamide (PubChem CID 171704756) has the molecular formula C17H17BrFN3O2 and a molecular weight of 394.24 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 171704756 |
| Molecular Formula | C17H17BrFN3O2 |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | N-(4-bromophenyl)-2-[3-[(6-fluoro-2-pyridinyl)oxy]pyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(Oc2cccc(F)n2)C1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrFN3O2/c18-12-4-6-13(7-5-12)20-16(23)11-22-9-8-14(10-22)24-17-3-1-2-15(19)21-17/h1-7,14H,8-11H2,(H,20,23) |
| InChIKey | YFPVVVOLAMNNQQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|