C13H16FN5O — CID 172904927
2-fluoro-6-[1-[2-(triazol-2-yl)ethyl]pyrrolidin-3-yl]oxypyridine (PubChem CID 172904927) has the molecular formula C13H16FN5O and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-fluoro-6-[1-[2-(triazol-2-yl)ethyl]pyrrolidin-3-yl]oxypyridine.
| Compound Name | 2-fluoro-6-[1-[2-(triazol-2-yl)ethyl]pyrrolidin-3-yl]oxypyridine |
|---|---|
| PubChem CID | 172904927 |
| Molecular Formula | C13H16FN5O |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-fluoro-6-[1-[2-(triazol-2-yl)ethyl]pyrrolidin-3-yl]oxypyridine |
| SMILES | Fc1cccc(OC2CCN(CCn3nccn3)C2)n1 |
| InChI | InChI=1S/C13H16FN5O/c14-12-2-1-3-13(17-12)20-11-4-7-18(10-11)8-9-19-15-5-6-16-19/h1-3,5-6,11H,4,7-10H2 |
| InChIKey | IHMJEFGOZJVGCI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|