C12H13N3OS — CID 127514333
1-benzyl-1-methyl-3-(1,3-thiazol-2-yl)urea (PubChem CID 127514333) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-benzyl-1-methyl-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-benzyl-1-methyl-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 127514333 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-benzyl-1-methyl-3-(1,3-thiazol-2-yl)urea |
| SMILES | CN(Cc1ccccc1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H13N3OS/c1-15(9-10-5-3-2-4-6-10)12(16)14-11-13-7-8-17-11/h2-8H,9H2,1H3,(H,13,14,16) |
| InChIKey | PXBBTVAZMZNXKY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |