C8H11N3OS — CID 131176329
1-methyl-1-prop-2-enyl-3-(1,3-thiazol-2-yl)urea (PubChem CID 131176329) has the molecular formula C8H11N3OS and a molecular weight of 197.26 g/mol. Its IUPAC name is 1-methyl-1-prop-2-enyl-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-methyl-1-prop-2-enyl-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 131176329 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 1-methyl-1-prop-2-enyl-3-(1,3-thiazol-2-yl)urea |
| SMILES | C=CCN(C)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C8H11N3OS/c1-3-5-11(2)8(12)10-7-9-4-6-13-7/h3-4,6H,1,5H2,2H3,(H,9,10,12) |
| InChIKey | JAUUNWUVRVGTQS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|